About cyclopenta[g][1,4]benzothiazine
cyclopenta[g][1,4]benzothiazine (PubChem CID 158777512) has the molecular formula C11H7NS
and a molecular weight of 185.25 g/mol. Its IUPAC name is cyclopenta[g][1,4]benzothiazine.
Molecular Properties
| Compound Name | cyclopenta[g][1,4]benzothiazine |
| PubChem CID | 158777512 |
| Molecular Formula | C11H7NS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | cyclopenta[g][1,4]benzothiazine |
| SMILES | c1cc2cc3nccsc3cc2c1 |
| InChI | InChI=1S/C11H7NS/c1-2-8-6-10-11(7-9(8)3-1)13-5-4-12-10/h1-7H |
| InChIKey | IQQQBSYTUULWER-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenta[g][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[g][1,4]benzothiazine?
The IUPAC name of cyclopenta[g][1,4]benzothiazine (CID 158777512) is cyclopenta[g][1,4]benzothiazine.
What is the SMILES notation for cyclopenta[g][1,4]benzothiazine?
The canonical SMILES for cyclopenta[g][1,4]benzothiazine is c1cc2cc3nccsc3cc2c1.
What is the InChIKey of cyclopenta[g][1,4]benzothiazine?
The InChIKey is IQQQBSYTUULWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NS/c1-2-8-6-10-11(7-9(8)3-1)13-5-4-12-10/h1-7H.
What are the key properties of cyclopenta[g][1,4]benzothiazine?
cyclopenta[g][1,4]benzothiazine has a molecular weight of 185.25 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[g][1,4]benzothiazine is sourced from PubChem (CID 158777512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).