About 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone
1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone (PubChem CID 158777737) has the molecular formula C32H27N3O2
and a molecular weight of 485.59 g/mol. Its IUPAC name is 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone.
Molecular Properties
| Compound Name | 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone |
| PubChem CID | 158777737 |
| Molecular Formula | C32H27N3O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone |
| SMILES | COC1=CC=C(C(=O)c2ccccc2)CC1(C)C.[N-]=[N+]=Nc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C16H9N3.C16H18O2/c17-19-18-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;1-16(2)11-13(9-10-14(16)18-3)15(17)12-7-5-4-6-8-12/h1-9H;4-10H,11H2,1-3H3 |
| InChIKey | IQRJTQGTIAIPAA-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone?
The IUPAC name of 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone (CID 158777737) is 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone.
What is the SMILES notation for 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone?
The canonical SMILES for 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone is COC1=CC=C(C(=O)c2ccccc2)CC1(C)C.[N-]=[N+]=Nc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone?
The InChIKey is IQRJTQGTIAIPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N3.C16H18O2/c17-19-18-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;1-16(2)11-13(9-10-14(16)18-3)15(17)12-7-5-4-6-8-12/h1-9H;4-10H,11H2,1-3H3.
What are the key properties of 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone?
1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone has a molecular weight of 485.59 g/mol, XLogP of 9.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azidopyrene;(4-methoxy-5,5-dimethylcyclohexa-1,3-dien-1-yl)-phenylmethanone is sourced from PubChem (CID 158777737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).