C10H8F5N3O2 — CID 158780073
2,4-dimethoxy-5-(1,1,2,2,2-pentafluoroethyl)-7H-pyrrolo[3,4-d]pyrimidine (PubChem CID 158780073) has the molecular formula C10H8F5N3O2 and a molecular weight of 297.18 g/mol. Its IUPAC name is 2,4-dimethoxy-5-(1,1,2,2,2-pentafluoroethyl)-7H-pyrrolo[3,4-d]pyrimidine.
| Compound Name | 2,4-dimethoxy-5-(1,1,2,2,2-pentafluoroethyl)-7H-pyrrolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 158780073 |
| Molecular Formula | C10H8F5N3O2 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2,4-dimethoxy-5-(1,1,2,2,2-pentafluoroethyl)-7H-pyrrolo[3,4-d]pyrimidine |
| SMILES | COc1nc2c(c(OC)n1)C(C(F)(F)C(F)(F)F)=NC2 |
| InChI | InChI=1S/C10H8F5N3O2/c1-19-7-5-4(17-8(18-7)20-2)3-16-6(5)9(11,12)10(13,14)15/h3H2,1-2H3 |
| InChIKey | IQYPPOXIPDOLAL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|