About 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one
6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 158783528) has the molecular formula C18H30N2O2
and a molecular weight of 306.45 g/mol. Its IUPAC name is 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one |
| PubChem CID | 158783528 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | CC1(C)CC2CCN1CC2=O.CCC1CC2CCN1CC2=O |
| InChI | InChI=1S/2C9H15NO/c1-9(2)5-7-3-4-10(9)6-8(7)11;1-2-8-5-7-3-4-10(8)6-9(7)11/h7H,3-6H2,1-2H3;7-8H,2-6H2,1H3 |
| InChIKey | IRJQOQZDDJOZAE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one?
The IUPAC name of 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one (CID 158783528) is 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one.
What is the SMILES notation for 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one?
The canonical SMILES for 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one is CC1(C)CC2CCN1CC2=O.CCC1CC2CCN1CC2=O.
What is the InChIKey of 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one?
The InChIKey is IRJQOQZDDJOZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H15NO/c1-9(2)5-7-3-4-10(9)6-8(7)11;1-2-8-5-7-3-4-10(8)6-9(7)11/h7H,3-6H2,1-2H3;7-8H,2-6H2,1H3.
What are the key properties of 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one?
6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one has a molecular weight of 306.45 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1-azabicyclo[2.2.2]octan-3-one;6-ethyl-1-azabicyclo[2.2.2]octan-3-one is sourced from PubChem (CID 158783528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).