About methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate
methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate (PubChem CID 158783761) has the molecular formula C15H24O7S2
and a molecular weight of 380.48 g/mol. Its IUPAC name is methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate |
| PubChem CID | 158783761 |
| Molecular Formula | C15H24O7S2 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate |
| SMILES | COC(=O)C1CSCCC1=O.COC(=O)CCSCCC(=O)OC |
| InChI | InChI=1S/C8H14O4S.C7H10O3S/c1-11-7(9)3-5-13-6-4-8(10)12-2;1-10-7(9)5-4-11-3-2-6(5)8/h3-6H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | IRKLDLBEWRFGDA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate?
The IUPAC name of methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate (CID 158783761) is methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate.
What is the SMILES notation for methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate?
The canonical SMILES for methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate is COC(=O)C1CSCCC1=O.COC(=O)CCSCCC(=O)OC.
What is the InChIKey of methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate?
The InChIKey is IRKLDLBEWRFGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4S.C7H10O3S/c1-11-7(9)3-5-13-6-4-8(10)12-2;1-10-7(9)5-4-11-3-2-6(5)8/h3-6H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate?
methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate has a molecular weight of 380.48 g/mol, XLogP of 1.33, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-methoxy-3-oxopropyl)sulfanylpropanoate;methyl 4-oxothiane-3-carboxylate is sourced from PubChem (CID 158783761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).