About 3-but-3-enyl-1H-indene
3-but-3-enyl-1H-indene (PubChem CID 15878391) has the molecular formula C13H14
and a molecular weight of 170.25 g/mol. Its IUPAC name is 3-but-3-enyl-1H-indene.
Molecular Properties
| Compound Name | 3-but-3-enyl-1H-indene |
| PubChem CID | 15878391 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-but-3-enyl-1H-indene |
| SMILES | C=CCCC1=CCc2ccccc21 |
| InChI | InChI=1S/C13H14/c1-2-3-6-11-9-10-12-7-4-5-8-13(11)12/h2,4-5,7-9H,1,3,6,10H2 |
| InChIKey | BQEPDJCQFWQELI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-enyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-enyl-1H-indene?
The IUPAC name of 3-but-3-enyl-1H-indene (CID 15878391) is 3-but-3-enyl-1H-indene.
What is the SMILES notation for 3-but-3-enyl-1H-indene?
The canonical SMILES for 3-but-3-enyl-1H-indene is C=CCCC1=CCc2ccccc21.
What is the InChIKey of 3-but-3-enyl-1H-indene?
The InChIKey is BQEPDJCQFWQELI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-2-3-6-11-9-10-12-7-4-5-8-13(11)12/h2,4-5,7-9H,1,3,6,10H2.
What are the key properties of 3-but-3-enyl-1H-indene?
3-but-3-enyl-1H-indene has a molecular weight of 170.25 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-enyl-1H-indene is sourced from PubChem (CID 15878391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).