C20H22Cl2N2O8S2 — CID 158784035
2-[6-(1,3-benzothiazol-3-ium-2-yl)hexyl]-1,3-benzothiazol-3-ium diperchlorate (PubChem CID 158784035) has the molecular formula C20H22Cl2N2O8S2 and a molecular weight of 553.44 g/mol. Its IUPAC name is 2-[6-(1,3-benzothiazol-3-ium-2-yl)hexyl]-1,3-benzothiazol-3-ium diperchlorate.
| Compound Name | 2-[6-(1,3-benzothiazol-3-ium-2-yl)hexyl]-1,3-benzothiazol-3-ium diperchlorate |
|---|---|
| PubChem CID | 158784035 |
| Molecular Formula | C20H22Cl2N2O8S2 |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | 2-[6-(1,3-benzothiazol-3-ium-2-yl)hexyl]-1,3-benzothiazol-3-ium diperchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-].c1ccc2sc(CCCCCCc3[nH+]c4ccccc4s3)[nH+]c2c1 |
| InChI | InChI=1S/C20H20N2S2.2ClHO4/c1(3-13-19-21-15-9-5-7-11-17(15)23-19)2-4-14-20-22-16-10-6-8-12-18(16)24-20;2*2-1(3,4)5/h5-12H,1-4,13-14H2;2*(H,2,3,4,5) |
| InChIKey | IRLHGHFRWNSIHA-UHFFFAOYSA-N |
| XLogP | -4.42 |
| TPSA | 212.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|