C23H22F2N8O2 — CID 158785960
1-[3-[1-(fluoromethyl)cyclopropyl]-1,2,4-oxadiazol-5-yl]-3-[3-fluoro-2-methyl-4-[4-[(1-methylpyrazol-3-yl)amino]-1,3,5-triazin-2-yl]phenyl]propan-1-one (PubChem CID 158785960) has the molecular formula C23H22F2N8O2 and a molecular weight of 480.48 g/mol. Its IUPAC name is 1-[3-[1-(fluoromethyl)cyclopropyl]-1,2,4-oxadiazol-5-yl]-3-[3-fluoro-2-methyl-4-[4-[(1-methylpyrazol-3-yl)amino]-1,3,5-triazin-2-yl]phenyl]propan-1-one.
| Compound Name | 1-[3-[1-(fluoromethyl)cyclopropyl]-1,2,4-oxadiazol-5-yl]-3-[3-fluoro-2-methyl-4-[4-[(1-methylpyrazol-3-yl)amino]-1,3,5-triazin-2-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 158785960 |
| Molecular Formula | C23H22F2N8O2 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1-[3-[1-(fluoromethyl)cyclopropyl]-1,2,4-oxadiazol-5-yl]-3-[3-fluoro-2-methyl-4-[4-[(1-methylpyrazol-3-yl)amino]-1,3,5-triazin-2-yl]phenyl]propan-1-one |
| SMILES | Cc1c(CCC(=O)c2nc(C3(CF)CC3)no2)ccc(-c2ncnc(Nc3ccn(C)n3)n2)c1F |
| InChI | InChI=1S/C23H22F2N8O2/c1-13-14(4-6-16(34)20-30-21(32-35-20)23(11-24)8-9-23)3-5-15(18(13)25)19-26-12-27-22(29-19)28-17-7-10-33(2)31-17/h3,5,7,10,12H,4,6,8-9,11H2,1-2H3,(H,26,27,28,29,31) |
| InChIKey | IRRLZJAUFJEDGJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |