C12H21F4N — CID 158786871
N-(cyclohexylmethyl)-2,2,4,4-tetrafluoropentan-1-amine (PubChem CID 158786871) has the molecular formula C12H21F4N and a molecular weight of 255.30 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,2,4,4-tetrafluoropentan-1-amine.
| Compound Name | N-(cyclohexylmethyl)-2,2,4,4-tetrafluoropentan-1-amine |
|---|---|
| PubChem CID | 158786871 |
| Molecular Formula | C12H21F4N |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-(cyclohexylmethyl)-2,2,4,4-tetrafluoropentan-1-amine |
| SMILES | CC(F)(F)CC(F)(F)CNCC1CCCCC1 |
| InChI | InChI=1S/C12H21F4N/c1-11(13,14)8-12(15,16)9-17-7-10-5-3-2-4-6-10/h10,17H,2-9H2,1H3 |
| InChIKey | BIMNGRVNZITRLC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |