C45H37NO2Si — CID 15878688
3,3,5,5,7,7-hexakis-phenyl-4,6-dioxa-13-aza-5-silabicyclo[7.3.1]trideca-1(13),9,11-triene (PubChem CID 15878688) has the molecular formula C45H37NO2Si and a molecular weight of 651.88 g/mol. Its IUPAC name is 3,3,5,5,7,7-hexakis-phenyl-4,6-dioxa-13-aza-5-silabicyclo[7.3.1]trideca-1(13),9,11-triene.
| Compound Name | 3,3,5,5,7,7-hexakis-phenyl-4,6-dioxa-13-aza-5-silabicyclo[7.3.1]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 15878688 |
| Molecular Formula | C45H37NO2Si |
| Molecular Weight | 651.88 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | 3,3,5,5,7,7-hexakis-phenyl-4,6-dioxa-13-aza-5-silabicyclo[7.3.1]trideca-1(13),9,11-triene |
| SMILES | c1ccc(C2(c3ccccc3)Cc3cccc(n3)CC(c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C45H37NO2Si/c1-7-20-36(21-8-1)44(37-22-9-2-10-23-37)34-40-28-19-29-41(46-40)35-45(38-24-11-3-12-25-38,39-26-13-4-14-27-39)48-49(47-44,42-30-15-5-16-31-42)43-32-17-6-18-33-43/h1-33H,34-35H2 |
| InChIKey | ZGIHJZPWAZOLRJ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.88 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|