C60H49IO7SSi4 — CID 158788055
diphenyliodanium;4-(2,4,4,6,6,8,8-heptakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)benzenesulfonate (PubChem CID 158788055) has the molecular formula C60H49IO7SSi4 and a molecular weight of 1153.36 g/mol. Its IUPAC name is diphenyliodanium;4-(2,4,4,6,6,8,8-heptakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)benzenesulfonate.
| Compound Name | diphenyliodanium;4-(2,4,4,6,6,8,8-heptakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 158788055 |
| Molecular Formula | C60H49IO7SSi4 |
| Molecular Weight | 1153.36 g/mol |
| Exact Mass | 1152.13 |
| IUPAC Name | diphenyliodanium;4-(2,4,4,6,6,8,8-heptakis-phenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc([Si]2(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)cc1.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C48H40O7SSi4.C12H10I/c49-56(50,51)40-36-38-48(39-37-40)60(47-34-20-7-21-35-47)54-58(43-26-12-3-13-27-43,44-28-14-4-15-29-44)52-57(41-22-8-1-9-23-41,42-24-10-2-11-25-42)53-59(55-60,45-30-16-5-17-31-45)46-32-18-6-19-33-46;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-39H,(H,49,50,51);1-10H/q;+1/p-1 |
| InChIKey | IRXVGZNJPKSBRZ-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 73 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1153.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|