About 2-(3-chlorophenyl)acetic acid
2-(3-chlorophenyl)acetic acid (PubChem CID 15879) has the molecular formula C8H7ClO2
and a molecular weight of 170.59 g/mol. Its IUPAC name is 2-(3-chlorophenyl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)acetic acid |
| PubChem CID | 15879 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.59 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | 2-(3-chlorophenyl)acetic acid |
| SMILES | O=C(O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H7ClO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | WFPMUFXQDKMVCO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-chlorophenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)acetic acid?
The IUPAC name of 2-(3-chlorophenyl)acetic acid (CID 15879) is 2-(3-chlorophenyl)acetic acid.
What is the SMILES notation for 2-(3-chlorophenyl)acetic acid?
The canonical SMILES for 2-(3-chlorophenyl)acetic acid is O=C(O)Cc1cccc(Cl)c1.
What is the InChIKey of 2-(3-chlorophenyl)acetic acid?
The InChIKey is WFPMUFXQDKMVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11).
What are the key properties of 2-(3-chlorophenyl)acetic acid?
2-(3-chlorophenyl)acetic acid has a molecular weight of 170.59 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)acetic acid is sourced from PubChem (CID 15879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).