About N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate
N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate (PubChem CID 158790924) has the molecular formula C12H25NO4S
and a molecular weight of 279.40 g/mol. Its IUPAC name is N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate.
Molecular Properties
| Compound Name | N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate |
| PubChem CID | 158790924 |
| Molecular Formula | C12H25NO4S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate |
| SMILES | CC(=O)[C@@H](CCC1CCCCC1)NS(C)(=O)=O.O |
| InChI | InChI=1S/C12H23NO3S.H2O/c1-10(14)12(13-17(2,15)16)9-8-11-6-4-3-5-7-11;/h11-13H,3-9H2,1-2H3;1H2/t12-;/m1./s1 |
| InChIKey | SWFKIJQLIZRIBZ-UTONKHPSSA-N |
| XLogP | 1.03 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate?
The IUPAC name of N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate (CID 158790924) is N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate.
What is the SMILES notation for N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate?
The canonical SMILES for N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate is CC(=O)[C@@H](CCC1CCCCC1)NS(C)(=O)=O.O.
What is the InChIKey of N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate?
The InChIKey is SWFKIJQLIZRIBZ-UTONKHPSSA-N. The full InChI is InChI=1S/C12H23NO3S.H2O/c1-10(14)12(13-17(2,15)16)9-8-11-6-4-3-5-7-11;/h11-13H,3-9H2,1-2H3;1H2/t12-;/m1./s1.
What are the key properties of N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate?
N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate has a molecular weight of 279.40 g/mol, XLogP of 1.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1-cyclohexyl-4-oxopentan-3-yl]methanesulfonamide;hydrate is sourced from PubChem (CID 158790924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).