About 5-diazocyclohexa-1,3-diene;formohydrazide
5-diazocyclohexa-1,3-diene;formohydrazide (PubChem CID 158790941) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-diazocyclohexa-1,3-diene;formohydrazide.
Molecular Properties
| Compound Name | 5-diazocyclohexa-1,3-diene;formohydrazide |
| PubChem CID | 158790941 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 5-diazocyclohexa-1,3-diene;formohydrazide |
| SMILES | NNC=O.[N-]=[N+]=C1C=CC=CC1 |
| InChI | InChI=1S/C6H6N2.CH4N2O/c7-8-6-4-2-1-3-5-6;2-3-1-4/h1-4H,5H2;1H,2H2,(H,3,4) |
| InChIKey | ISGQPNNARTUDSX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 5-diazocyclohexa-1,3-diene;formohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazocyclohexa-1,3-diene;formohydrazide?
The IUPAC name of 5-diazocyclohexa-1,3-diene;formohydrazide (CID 158790941) is 5-diazocyclohexa-1,3-diene;formohydrazide.
What is the SMILES notation for 5-diazocyclohexa-1,3-diene;formohydrazide?
The canonical SMILES for 5-diazocyclohexa-1,3-diene;formohydrazide is NNC=O.[N-]=[N+]=C1C=CC=CC1.
What is the InChIKey of 5-diazocyclohexa-1,3-diene;formohydrazide?
The InChIKey is ISGQPNNARTUDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2.CH4N2O/c7-8-6-4-2-1-3-5-6;2-3-1-4/h1-4H,5H2;1H,2H2,(H,3,4).
What are the key properties of 5-diazocyclohexa-1,3-diene;formohydrazide?
5-diazocyclohexa-1,3-diene;formohydrazide has a molecular weight of 166.18 g/mol, XLogP of -0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazocyclohexa-1,3-diene;formohydrazide is sourced from PubChem (CID 158790941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).