C27H18Br2ClF6N5 — CID 158792863
(4-bromo-2-methylphenyl)methanimine;6-bromo-1-[6-(trifluoromethyl)-2-pyridinyl]indazole;2-chloro-6-(trifluoromethyl)pyridine (PubChem CID 158792863) has the molecular formula C27H18Br2ClF6N5 and a molecular weight of 721.73 g/mol. Its IUPAC name is (4-bromo-2-methylphenyl)methanimine;6-bromo-1-[6-(trifluoromethyl)-2-pyridinyl]indazole;2-chloro-6-(trifluoromethyl)pyridine.
| Compound Name | (4-bromo-2-methylphenyl)methanimine;6-bromo-1-[6-(trifluoromethyl)-2-pyridinyl]indazole;2-chloro-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 158792863 |
| Molecular Formula | C27H18Br2ClF6N5 |
| Molecular Weight | 721.73 g/mol |
| Exact Mass | 718.95 |
| IUPAC Name | (4-bromo-2-methylphenyl)methanimine;6-bromo-1-[6-(trifluoromethyl)-2-pyridinyl]indazole;2-chloro-6-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cccc(-n2ncc3ccc(Br)cc32)n1.FC(F)(F)c1cccc(Cl)n1.[H]/N=C/c1ccc(Br)cc1C |
| InChI | InChI=1S/C13H7BrF3N3.C8H8BrN.C6H3ClF3N/c14-9-5-4-8-7-18-20(10(8)6-9)12-3-1-2-11(19-12)13(15,16)17;1-6-4-8(9)3-2-7(6)5-10;7-5-3-1-2-4(11-5)6(8,9)10/h1-7H;2-5,10H,1H3;1-3H/b;10-5+; |
| InChIKey | ISMNTXWWSOKPCB-ATWZUJJXSA-N |
| XLogP | 9.71 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.73 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|