About actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole
actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole (PubChem CID 158796058) has the molecular formula C14H19Ac2ClN6S2-2
and a molecular weight of 824.93 g/mol. Its IUPAC name is actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole.
Molecular Properties
| Compound Name | actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole |
| PubChem CID | 158796058 |
| Molecular Formula | C14H19Ac2ClN6S2-2 |
| Molecular Weight | 824.93 g/mol |
| Exact Mass | 824.14 |
| IUPAC Name | actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole |
| SMILES | Clc1cnc(N2CC[N-]CC2)s1.[Ac].[Ac].c1csc(N2CC[N-]CC2)n1 |
| InChI | InChI=1S/C7H9ClN3S.C7H10N3S.2Ac/c8-6-5-10-7(12-6)11-3-1-9-2-4-11;1-4-10(5-2-8-1)7-9-3-6-11-7;;/h5H,1-4H2;3,6H,1-2,4-5H2;;/q2*-1;; |
| InChIKey | YZYVIZREKYPENC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 824.93 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole?
The IUPAC name of actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole (CID 158796058) is actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole.
What is the SMILES notation for actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole?
The canonical SMILES for actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole is Clc1cnc(N2CC[N-]CC2)s1.[Ac].[Ac].c1csc(N2CC[N-]CC2)n1.
What is the InChIKey of actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole?
The InChIKey is YZYVIZREKYPENC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN3S.C7H10N3S.2Ac/c8-6-5-10-7(12-6)11-3-1-9-2-4-11;1-4-10(5-2-8-1)7-9-3-6-11-7;;/h5H,1-4H2;3,6H,1-2,4-5H2;;/q2*-1;;.
What are the key properties of actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole?
actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole has a molecular weight of 824.93 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;5-chloro-2-piperazin-4-id-1-yl-1,3-thiazole;2-piperazin-4-id-1-yl-1,3-thiazole is sourced from PubChem (CID 158796058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).