C20H33NO8 — CID 158796288
1,3-dimethylpyrrolidine-2,5-dione;2-methyl-4-oxohexanoic acid;3-methyl-4-oxohexanoic acid (PubChem CID 158796288) has the molecular formula C20H33NO8 and a molecular weight of 415.48 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidine-2,5-dione;2-methyl-4-oxohexanoic acid;3-methyl-4-oxohexanoic acid.
| Compound Name | 1,3-dimethylpyrrolidine-2,5-dione;2-methyl-4-oxohexanoic acid;3-methyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 158796288 |
| Molecular Formula | C20H33NO8 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1,3-dimethylpyrrolidine-2,5-dione;2-methyl-4-oxohexanoic acid;3-methyl-4-oxohexanoic acid |
| SMILES | CC1CC(=O)N(C)C1=O.CCC(=O)C(C)CC(=O)O.CCC(=O)CC(C)C(=O)O |
| InChI | InChI=1S/2C7H12O3.C6H9NO2/c1-3-6(8)5(2)4-7(9)10;1-3-6(8)4-5(2)7(9)10;1-4-3-5(8)7(2)6(4)9/h2*5H,3-4H2,1-2H3,(H,9,10);4H,3H2,1-2H3 |
| InChIKey | ISXBSCYVUZCUTC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 146.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|