About 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline
2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline (PubChem CID 15879776) has the molecular formula C16H16N2O
and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline.
Molecular Properties
| Compound Name | 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
| PubChem CID | 15879776 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline |
| SMILES | Nc1ccccc1C1=N[C@@H](Cc2ccccc2)CO1 |
| InChI | InChI=1S/C16H16N2O/c17-15-9-5-4-8-14(15)16-18-13(11-19-16)10-12-6-2-1-3-7-12/h1-9,13H,10-11,17H2/t13-/m0/s1 |
| InChIKey | ZNHOQAYNVLEAPF-ZDUSSCGKSA-N |
| XLogP | 2.66 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline?
The IUPAC name of 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline (CID 15879776) is 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline.
What is the SMILES notation for 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline?
The canonical SMILES for 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline is Nc1ccccc1C1=N[C@@H](Cc2ccccc2)CO1.
What is the InChIKey of 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline?
The InChIKey is ZNHOQAYNVLEAPF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H16N2O/c17-15-9-5-4-8-14(15)16-18-13(11-19-16)10-12-6-2-1-3-7-12/h1-9,13H,10-11,17H2/t13-/m0/s1.
What are the key properties of 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline?
2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline has a molecular weight of 252.32 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]aniline is sourced from PubChem (CID 15879776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).