C20H24ClF4NO4S3 — CID 158798023
4-(4-benzylpiperidin-1-yl)sulfonyl-2,3,5,6-tetrafluorobenzenesulfonyl chloride;ethane;sulfane (PubChem CID 158798023) has the molecular formula C20H24ClF4NO4S3 and a molecular weight of 550.06 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)sulfonyl-2,3,5,6-tetrafluorobenzenesulfonyl chloride;ethane;sulfane.
| Compound Name | 4-(4-benzylpiperidin-1-yl)sulfonyl-2,3,5,6-tetrafluorobenzenesulfonyl chloride;ethane;sulfane |
|---|---|
| PubChem CID | 158798023 |
| Molecular Formula | C20H24ClF4NO4S3 |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)sulfonyl-2,3,5,6-tetrafluorobenzenesulfonyl chloride;ethane;sulfane |
| SMILES | CC.O=S(=O)(Cl)c1c(F)c(F)c(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)c(F)c1F.S |
| InChI | InChI=1S/C18H16ClF4NO4S2.C2H6.H2S/c19-29(25,26)17-13(20)15(22)18(16(23)14(17)21)30(27,28)24-8-6-12(7-9-24)10-11-4-2-1-3-5-11;1-2;/h1-5,12H,6-10H2;1-2H3;1H2 |
| InChIKey | ITCLQQXYVPBLNW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|