C9H14N2O3 — CID 158798966
ethanol;2-(2-methylpyrazol-3-yl)prop-2-enoic acid (PubChem CID 158798966) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is ethanol;2-(2-methylpyrazol-3-yl)prop-2-enoic acid.
| Compound Name | ethanol;2-(2-methylpyrazol-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 158798966 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | ethanol;2-(2-methylpyrazol-3-yl)prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccnn1C.CCO |
| InChI | InChI=1S/C7H8N2O2.C2H6O/c1-5(7(10)11)6-3-4-8-9(6)2;1-2-3/h3-4H,1H2,2H3,(H,10,11);3H,2H2,1H3 |
| InChIKey | ITFRVZSYQMYZPH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|