C32H28N2O2 — CID 158800892
5-[[4-ethynyl-2-[(5-hydroxy-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)methylideneamino]phenyl]iminomethyl]tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ol (PubChem CID 158800892) has the molecular formula C32H28N2O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 5-[[4-ethynyl-2-[(5-hydroxy-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)methylideneamino]phenyl]iminomethyl]tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ol.
| Compound Name | 5-[[4-ethynyl-2-[(5-hydroxy-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)methylideneamino]phenyl]iminomethyl]tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 158800892 |
| Molecular Formula | C32H28N2O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 5-[[4-ethynyl-2-[(5-hydroxy-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)methylideneamino]phenyl]iminomethyl]tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ol |
| SMILES | C#Cc1ccc(/N=C/c2cc3c(cc2O)C2CCC3C2)c(/N=C/c2cc3c(cc2O)C2CCC3C2)c1 |
| InChI | InChI=1S/C32H28N2O2/c1-2-18-3-8-29(33-16-23-12-25-19-4-6-21(10-19)27(25)14-31(23)35)30(9-18)34-17-24-13-26-20-5-7-22(11-20)28(26)15-32(24)36/h1,3,8-9,12-17,19-22,35-36H,4-7,10-11H2/b33-16+,34-17+ |
| InChIKey | GHTHDCPPHZOUNX-CQFHKPFHSA-N |
| XLogP | 7.31 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|