C9H6F6N2O2 — CID 158801707
1,1,1,5,5,5-hexafluoro-4-hydroxy-3-(1-methylimidazol-2-yl)pent-3-en-2-one (PubChem CID 158801707) has the molecular formula C9H6F6N2O2 and a molecular weight of 288.15 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-hydroxy-3-(1-methylimidazol-2-yl)pent-3-en-2-one.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-hydroxy-3-(1-methylimidazol-2-yl)pent-3-en-2-one |
|---|---|
| PubChem CID | 158801707 |
| Molecular Formula | C9H6F6N2O2 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-hydroxy-3-(1-methylimidazol-2-yl)pent-3-en-2-one |
| SMILES | Cn1ccnc1C(C(=O)C(F)(F)F)=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H6F6N2O2/c1-17-3-2-16-7(17)4(5(18)8(10,11)12)6(19)9(13,14)15/h2-3,18H,1H3 |
| InChIKey | MJUCEYKRZFXGCM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|