C24H30N4O5S — CID 158801869
7-(3-ethyl-6-piperazin-1-ylindol-1-yl)sulfonyl-4-methyl-2,3-dihydro-1,4-benzoxazine;formic acid (PubChem CID 158801869) has the molecular formula C24H30N4O5S and a molecular weight of 486.59 g/mol. Its IUPAC name is 7-(3-ethyl-6-piperazin-1-ylindol-1-yl)sulfonyl-4-methyl-2,3-dihydro-1,4-benzoxazine;formic acid.
| Compound Name | 7-(3-ethyl-6-piperazin-1-ylindol-1-yl)sulfonyl-4-methyl-2,3-dihydro-1,4-benzoxazine;formic acid |
|---|---|
| PubChem CID | 158801869 |
| Molecular Formula | C24H30N4O5S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 7-(3-ethyl-6-piperazin-1-ylindol-1-yl)sulfonyl-4-methyl-2,3-dihydro-1,4-benzoxazine;formic acid |
| SMILES | CCc1cn(S(=O)(=O)c2ccc3c(c2)OCCN3C)c2cc(N3CCNCC3)ccc12.O=CO |
| InChI | InChI=1S/C23H28N4O3S.CH2O2/c1-3-17-16-27(22-14-18(4-6-20(17)22)26-10-8-24-9-11-26)31(28,29)19-5-7-21-23(15-19)30-13-12-25(21)2;2-1-3/h4-7,14-16,24H,3,8-13H2,1-2H3;1H,(H,2,3) |
| InChIKey | ITOWWUYHYIJSFO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|