About 2-methylpropyl 4,4,4-trichlorobutanoate
2-methylpropyl 4,4,4-trichlorobutanoate (PubChem CID 15880194) has the molecular formula C8H13Cl3O2
and a molecular weight of 247.55 g/mol. Its IUPAC name is 2-methylpropyl 4,4,4-trichlorobutanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 4,4,4-trichlorobutanoate |
| PubChem CID | 15880194 |
| Molecular Formula | C8H13Cl3O2 |
| Molecular Weight | 247.55 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 2-methylpropyl 4,4,4-trichlorobutanoate |
| SMILES | CC(C)COC(=O)CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H13Cl3O2/c1-6(2)5-13-7(12)3-4-8(9,10)11/h6H,3-5H2,1-2H3 |
| InChIKey | ZNYVYATZWYEXFE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 4,4,4-trichlorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 4,4,4-trichlorobutanoate?
The IUPAC name of 2-methylpropyl 4,4,4-trichlorobutanoate (CID 15880194) is 2-methylpropyl 4,4,4-trichlorobutanoate.
What is the SMILES notation for 2-methylpropyl 4,4,4-trichlorobutanoate?
The canonical SMILES for 2-methylpropyl 4,4,4-trichlorobutanoate is CC(C)COC(=O)CCC(Cl)(Cl)Cl.
What is the InChIKey of 2-methylpropyl 4,4,4-trichlorobutanoate?
The InChIKey is ZNYVYATZWYEXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl3O2/c1-6(2)5-13-7(12)3-4-8(9,10)11/h6H,3-5H2,1-2H3.
What are the key properties of 2-methylpropyl 4,4,4-trichlorobutanoate?
2-methylpropyl 4,4,4-trichlorobutanoate has a molecular weight of 247.55 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 4,4,4-trichlorobutanoate is sourced from PubChem (CID 15880194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).