C20H20Cl2N2O — CID 158802583
N-benzyl-6,7-dichlorospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine (PubChem CID 158802583) has the molecular formula C20H20Cl2N2O and a molecular weight of 375.30 g/mol. Its IUPAC name is N-benzyl-6,7-dichlorospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine.
| Compound Name | N-benzyl-6,7-dichlorospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 158802583 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-benzyl-6,7-dichlorospiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
| SMILES | Clc1cc2c(cc1Cl)N/C(=N\Cc1ccccc1)C1(CCOCC1)C2 |
| InChI | InChI=1S/C20H20Cl2N2O/c21-16-10-15-12-20(6-8-25-9-7-20)19(24-18(15)11-17(16)22)23-13-14-4-2-1-3-5-14/h1-5,10-11H,6-9,12-13H2,(H,23,24) |
| InChIKey | ITRFFWNFZNSZMY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|