C24H39N2+ — CID 158803013
(2Z)-1-methyl-2-[(3Z,5E,7Z)-3,4,5,6,7-pentamethyl-8-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)nona-3,5,7-trien-2-ylidene]pyrrolidine (PubChem CID 158803013) has the molecular formula C24H39N2+ and a molecular weight of 355.59 g/mol. Its IUPAC name is (2Z)-1-methyl-2-[(3Z,5E,7Z)-3,4,5,6,7-pentamethyl-8-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)nona-3,5,7-trien-2-ylidene]pyrrolidine.
| Compound Name | (2Z)-1-methyl-2-[(3Z,5E,7Z)-3,4,5,6,7-pentamethyl-8-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)nona-3,5,7-trien-2-ylidene]pyrrolidine |
|---|---|
| PubChem CID | 158803013 |
| Molecular Formula | C24H39N2+ |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | (2Z)-1-methyl-2-[(3Z,5E,7Z)-3,4,5,6,7-pentamethyl-8-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)nona-3,5,7-trien-2-ylidene]pyrrolidine |
| SMILES | C/C(C1=[N+](C)CCC1)=C(C)/C(C)=C(C)/C(C)=C(C)\C(C)=C1\CCCN1C |
| InChI | InChI=1S/C24H39N2/c1-16(17(2)19(4)21(6)23-12-10-14-25(23)8)18(3)20(5)22(7)24-13-11-15-26(24)9/h10-15H2,1-9H3/q+1 |
| InChIKey | UXYPOYKKGACWRC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|