C26H41N2+ — CID 158803014
N,N,2,3-tetramethyl-4-[(2E,4E,6Z)-3,4,5,6-tetramethyl-7-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)octa-2,4,6-trien-2-yl]cyclopenta-1,3-dien-1-amine (PubChem CID 158803014) has the molecular formula C26H41N2+ and a molecular weight of 381.63 g/mol. Its IUPAC name is N,N,2,3-tetramethyl-4-[(2E,4E,6Z)-3,4,5,6-tetramethyl-7-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)octa-2,4,6-trien-2-yl]cyclopenta-1,3-dien-1-amine.
| Compound Name | N,N,2,3-tetramethyl-4-[(2E,4E,6Z)-3,4,5,6-tetramethyl-7-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)octa-2,4,6-trien-2-yl]cyclopenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 158803014 |
| Molecular Formula | C26H41N2+ |
| Molecular Weight | 381.63 g/mol |
| Exact Mass | 381.33 |
| IUPAC Name | N,N,2,3-tetramethyl-4-[(2E,4E,6Z)-3,4,5,6-tetramethyl-7-(1-methyl-3,4-dihydro-2H-pyrrol-1-ium-5-yl)octa-2,4,6-trien-2-yl]cyclopenta-1,3-dien-1-amine |
| SMILES | CC1=C(/C(C)=C(C)/C(C)=C(C)/C(C)=C(/C)C2=[N+](C)CCC2)CC(N(C)C)=C1C |
| InChI | InChI=1S/C26H41N2/c1-16(17(2)19(4)22(7)25-13-12-14-28(25)11)18(3)20(5)24-15-26(27(9)10)23(8)21(24)6/h12-15H2,1-11H3/q+1 |
| InChIKey | GMZGOLQZABOSNC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|