C13H17O4Se+ — CID 15880534
dimethyl 1-methyl-4-propan-2-ylideneselenopyran-1-ium-2,6-dicarboxylate (PubChem CID 15880534) has the molecular formula C13H17O4Se+ and a molecular weight of 316.24 g/mol. Its IUPAC name is dimethyl 1-methyl-4-propan-2-ylideneselenopyran-1-ium-2,6-dicarboxylate.
| Compound Name | dimethyl 1-methyl-4-propan-2-ylideneselenopyran-1-ium-2,6-dicarboxylate |
|---|---|
| PubChem CID | 15880534 |
| Molecular Formula | C13H17O4Se+ |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | dimethyl 1-methyl-4-propan-2-ylideneselenopyran-1-ium-2,6-dicarboxylate |
| SMILES | COC(=O)C1=CC(=C(C)C)C=C(C(=O)OC)[Se+]1C |
| InChI | InChI=1S/C13H17O4Se/c1-8(2)9-6-10(12(14)16-3)18(5)11(7-9)13(15)17-4/h6-7H,1-5H3/q+1 |
| InChIKey | MAUOMGBMOOUMTJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|