About 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol
2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol (PubChem CID 158805462) has the molecular formula C18H18F2O6
and a molecular weight of 368.33 g/mol. Its IUPAC name is 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol.
Molecular Properties
| Compound Name | 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol |
| PubChem CID | 158805462 |
| Molecular Formula | C18H18F2O6 |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol |
| SMILES | CCOC(=O)c1cccc(F)c1C(=O)O.OCc1cccc(F)c1CO |
| InChI | InChI=1S/C10H9FO4.C8H9FO2/c1-2-15-10(14)6-4-3-5-7(11)8(6)9(12)13;9-8-3-1-2-6(4-10)7(8)5-11/h3-5H,2H2,1H3,(H,12,13);1-3,10-11H,4-5H2 |
| InChIKey | IUADAGKGNUXRQB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol?
The IUPAC name of 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol (CID 158805462) is 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol.
What is the SMILES notation for 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol?
The canonical SMILES for 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol is CCOC(=O)c1cccc(F)c1C(=O)O.OCc1cccc(F)c1CO.
What is the InChIKey of 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol?
The InChIKey is IUADAGKGNUXRQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO4.C8H9FO2/c1-2-15-10(14)6-4-3-5-7(11)8(6)9(12)13;9-8-3-1-2-6(4-10)7(8)5-11/h3-5H,2H2,1H3,(H,12,13);1-3,10-11H,4-5H2.
What are the key properties of 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol?
2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol has a molecular weight of 368.33 g/mol, XLogP of 2.51, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxycarbonyl-6-fluorobenzoic acid;[3-fluoro-2-(hydroxymethyl)phenyl]methanol is sourced from PubChem (CID 158805462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).