C26H28FN3O3 — CID 158805804
5-[2-[(3S,9aR)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-4-methyl-3H-2-benzofuran-1-one (PubChem CID 158805804) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is 5-[2-[(3S,9aR)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 5-[2-[(3S,9aR)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 158805804 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 5-[2-[(3S,9aR)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-4-methyl-3H-2-benzofuran-1-one |
| SMILES | [C-]#[N+]c1c(F)ccc([C@H]2CN3CCN(CCc4ccc5c(c4C)COC5=O)C[C@@H]3CO2)c1C |
| InChI | InChI=1S/C26H28FN3O3/c1-16-18(4-5-21-22(16)15-33-26(21)31)8-9-29-10-11-30-13-24(32-14-19(30)12-29)20-6-7-23(27)25(28-3)17(20)2/h4-7,19,24H,8-15H2,1-2H3/t19-,24-/m1/s1 |
| InChIKey | IUBGQIHGBJQTCM-NTKDMRAZSA-N |
| XLogP | 3.96 |
| TPSA | 46.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|