About 1-pyrazin-2-ylhexan-1-ol
1-pyrazin-2-ylhexan-1-ol (PubChem CID 15880595) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-pyrazin-2-ylhexan-1-ol.
Molecular Properties
| Compound Name | 1-pyrazin-2-ylhexan-1-ol |
| PubChem CID | 15880595 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-pyrazin-2-ylhexan-1-ol |
| SMILES | CCCCCC(O)c1cnccn1 |
| InChI | InChI=1S/C10H16N2O/c1-2-3-4-5-10(13)9-8-11-6-7-12-9/h6-8,10,13H,2-5H2,1H3 |
| InChIKey | FQFPODQUWBOCOD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pyrazin-2-ylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazin-2-ylhexan-1-ol?
The IUPAC name of 1-pyrazin-2-ylhexan-1-ol (CID 15880595) is 1-pyrazin-2-ylhexan-1-ol.
What is the SMILES notation for 1-pyrazin-2-ylhexan-1-ol?
The canonical SMILES for 1-pyrazin-2-ylhexan-1-ol is CCCCCC(O)c1cnccn1.
What is the InChIKey of 1-pyrazin-2-ylhexan-1-ol?
The InChIKey is FQFPODQUWBOCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-3-4-5-10(13)9-8-11-6-7-12-9/h6-8,10,13H,2-5H2,1H3.
What are the key properties of 1-pyrazin-2-ylhexan-1-ol?
1-pyrazin-2-ylhexan-1-ol has a molecular weight of 180.25 g/mol, XLogP of 2.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazin-2-ylhexan-1-ol is sourced from PubChem (CID 15880595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).