About N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide
N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide (PubChem CID 158806788) has the molecular formula C12H14N6O2
and a molecular weight of 274.28 g/mol. Its IUPAC name is N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 158806788 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1cnc(N2CCNCC2)nc1)c1cocn1 |
| InChI | InChI=1S/C12H14N6O2/c19-11(10-7-20-8-16-10)17-9-5-14-12(15-6-9)18-3-1-13-2-4-18/h5-8,13H,1-4H2,(H,17,19) |
| InChIKey | IUEDFIIVABHWHA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide (CID 158806788) is N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide is O=C(Nc1cnc(N2CCNCC2)nc1)c1cocn1.
What is the InChIKey of N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide?
The InChIKey is IUEDFIIVABHWHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6O2/c19-11(10-7-20-8-16-10)17-9-5-14-12(15-6-9)18-3-1-13-2-4-18/h5-8,13H,1-4H2,(H,17,19).
What are the key properties of N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide?
N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide has a molecular weight of 274.28 g/mol, XLogP of 0.13, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-piperazin-1-ylpyrimidin-5-yl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 158806788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).