C11H8F3NO4 — CID 158807075
3-hydroxy-4-[[2,2,2-trifluoro-1-(5-methylfuran-2-yl)ethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 158807075) has the molecular formula C11H8F3NO4 and a molecular weight of 275.18 g/mol. Its IUPAC name is 3-hydroxy-4-[[2,2,2-trifluoro-1-(5-methylfuran-2-yl)ethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-hydroxy-4-[[2,2,2-trifluoro-1-(5-methylfuran-2-yl)ethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 158807075 |
| Molecular Formula | C11H8F3NO4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-hydroxy-4-[[2,2,2-trifluoro-1-(5-methylfuran-2-yl)ethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(C(Nc2c(O)c(=O)c2=O)C(F)(F)F)o1 |
| InChI | InChI=1S/C11H8F3NO4/c1-4-2-3-5(19-4)10(11(12,13)14)15-6-7(16)9(18)8(6)17/h2-3,10,15-16H,1H3 |
| InChIKey | IUEZLSJKOIGEAV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|