About (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten
(6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten (PubChem CID 158808091) has the molecular formula C9H11BBrF2NO3W
and a molecular weight of 493.74 g/mol. Its IUPAC name is (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten.
Molecular Properties
| Compound Name | (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten |
| PubChem CID | 158808091 |
| Molecular Formula | C9H11BBrF2NO3W |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 492.95 |
| IUPAC Name | (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten |
| SMILES | CC(C)Oc1ccc(Br)c(B(O)O)c1F.FN=[W] |
| InChI | InChI=1S/C9H11BBrFO3.FN.W/c1-5(2)15-7-4-3-6(11)8(9(7)12)10(13)14;1-2;/h3-5,13-14H,1-2H3;; |
| InChIKey | RBIMMNSQFIMJLH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten?
The IUPAC name of (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten (CID 158808091) is (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten.
What is the SMILES notation for (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten?
The canonical SMILES for (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten is CC(C)Oc1ccc(Br)c(B(O)O)c1F.FN=[W].
What is the InChIKey of (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten?
The InChIKey is RBIMMNSQFIMJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BBrFO3.FN.W/c1-5(2)15-7-4-3-6(11)8(9(7)12)10(13)14;1-2;/h3-5,13-14H,1-2H3;;.
What are the key properties of (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten?
(6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten has a molecular weight of 493.74 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2-fluoro-3-propan-2-yloxyphenyl)boronic acid;fluoroiminotungsten is sourced from PubChem (CID 158808091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).