About N,N-dimethylformamide;methylsulfanylmethane
N,N-dimethylformamide;methylsulfanylmethane (PubChem CID 158808099) has the molecular formula C5H13NOS
and a molecular weight of 135.23 g/mol. Its IUPAC name is N,N-dimethylformamide;methylsulfanylmethane.
Molecular Properties
| Compound Name | N,N-dimethylformamide;methylsulfanylmethane |
| PubChem CID | 158808099 |
| Molecular Formula | C5H13NOS |
| Molecular Weight | 135.23 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | N,N-dimethylformamide;methylsulfanylmethane |
| SMILES | CN(C)C=O.CSC |
| InChI | InChI=1S/C3H7NO.C2H6S/c1-4(2)3-5;1-3-2/h3H,1-2H3;1-2H3 |
| InChIKey | IUIKQDHMWITRPT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;methylsulfanylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;methylsulfanylmethane?
The IUPAC name of N,N-dimethylformamide;methylsulfanylmethane (CID 158808099) is N,N-dimethylformamide;methylsulfanylmethane.
What is the SMILES notation for N,N-dimethylformamide;methylsulfanylmethane?
The canonical SMILES for N,N-dimethylformamide;methylsulfanylmethane is CN(C)C=O.CSC.
What is the InChIKey of N,N-dimethylformamide;methylsulfanylmethane?
The InChIKey is IUIKQDHMWITRPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2H6S/c1-4(2)3-5;1-3-2/h3H,1-2H3;1-2H3.
What are the key properties of N,N-dimethylformamide;methylsulfanylmethane?
N,N-dimethylformamide;methylsulfanylmethane has a molecular weight of 135.23 g/mol, XLogP of 0.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;methylsulfanylmethane is sourced from PubChem (CID 158808099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).