C31H42N4O6 — CID 158808318
4-(6,6-dimethylmorpholin-2-yl)phenol;3-morpholin-2-ylphenol;6-morpholin-2-ylpyridin-3-ol (PubChem CID 158808318) has the molecular formula C31H42N4O6 and a molecular weight of 566.70 g/mol. Its IUPAC name is 4-(6,6-dimethylmorpholin-2-yl)phenol;3-morpholin-2-ylphenol;6-morpholin-2-ylpyridin-3-ol.
| Compound Name | 4-(6,6-dimethylmorpholin-2-yl)phenol;3-morpholin-2-ylphenol;6-morpholin-2-ylpyridin-3-ol |
|---|---|
| PubChem CID | 158808318 |
| Molecular Formula | C31H42N4O6 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 4-(6,6-dimethylmorpholin-2-yl)phenol;3-morpholin-2-ylphenol;6-morpholin-2-ylpyridin-3-ol |
| SMILES | CC1(C)CNCC(c2ccc(O)cc2)O1.Oc1ccc(C2CNCCO2)nc1.Oc1cccc(C2CNCCO2)c1 |
| InChI | InChI=1S/C12H17NO2.C10H13NO2.C9H12N2O2/c1-12(2)8-13-7-11(15-12)9-3-5-10(14)6-4-9;12-9-3-1-2-8(6-9)10-7-11-4-5-13-10;12-7-1-2-8(11-5-7)9-6-10-3-4-13-9/h3-6,11,13-14H,7-8H2,1-2H3;1-3,6,10-12H,4-5,7H2;1-2,5,9-10,12H,3-4,6H2 |
| InChIKey | IUJATJLHUNHZTP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |