C26H40O10 — CID 158808466
methanol;prop-2-enyl 1-(2-acetyloxyethyl)-2-oxocyclopentane-1-carboxylate;prop-2-enyl 6a-methoxy-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate (PubChem CID 158808466) has the molecular formula C26H40O10 and a molecular weight of 512.60 g/mol. Its IUPAC name is methanol;prop-2-enyl 1-(2-acetyloxyethyl)-2-oxocyclopentane-1-carboxylate;prop-2-enyl 6a-methoxy-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate.
| Compound Name | methanol;prop-2-enyl 1-(2-acetyloxyethyl)-2-oxocyclopentane-1-carboxylate;prop-2-enyl 6a-methoxy-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate |
|---|---|
| PubChem CID | 158808466 |
| Molecular Formula | C26H40O10 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | methanol;prop-2-enyl 1-(2-acetyloxyethyl)-2-oxocyclopentane-1-carboxylate;prop-2-enyl 6a-methoxy-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-3a-carboxylate |
| SMILES | C=CCOC(=O)C1(CCOC(C)=O)CCCC1=O.C=CCOC(=O)C12CCCC1(OC)OCC2.CO |
| InChI | InChI=1S/C13H18O5.C12H18O4.CH4O/c1-3-8-18-12(16)13(6-4-5-11(13)15)7-9-17-10(2)14;1-3-8-15-10(13)11-5-4-6-12(11,14-2)16-9-7-11;1-2/h3H,1,4-9H2,2H3;3H,1,4-9H2,2H3;2H,1H3 |
| InChIKey | IUJLMPMWMCQKKP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|