About CID 158808778
CID 158808778 (PubChem CID 158808778) has the molecular formula C3H6N6OSi
and a molecular weight of 170.21 g/mol.
Molecular Properties
| Compound Name | CID 158808778 |
| PubChem CID | 158808778 |
| Molecular Formula | C3H6N6OSi |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | — |
| SMILES | Nc1nc(N)nc(N)n1.O=[Si] |
| InChI | InChI=1S/C3H6N6.OSi/c4-1-7-2(5)9-3(6)8-1;1-2/h(H6,4,5,6,7,8,9); |
| InChIKey | IUKIGEJOJAUDJZ-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158808778 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158808778?
The IUPAC name of CID 158808778 (CID 158808778) is not available.
What is the SMILES notation for CID 158808778?
The canonical SMILES for CID 158808778 is Nc1nc(N)nc(N)n1.O=[Si].
What is the InChIKey of CID 158808778?
The InChIKey is IUKIGEJOJAUDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N6.OSi/c4-1-7-2(5)9-3(6)8-1;1-2/h(H6,4,5,6,7,8,9);.
What are the key properties of CID 158808778?
CID 158808778 has a molecular weight of 170.21 g/mol, XLogP of -1.88, 0 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158808778 is sourced from PubChem (CID 158808778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).