C19H28BN5O2 — CID 158809388
pyrimidine;1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine (PubChem CID 158809388) has the molecular formula C19H28BN5O2 and a molecular weight of 369.28 g/mol. Its IUPAC name is pyrimidine;1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine.
| Compound Name | pyrimidine;1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 158809388 |
| Molecular Formula | C19H28BN5O2 |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | pyrimidine;1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
| SMILES | CC1(C)OB(c2ccc(N3CCNCC3)nc2)OC1(C)C.c1cncnc1 |
| InChI | InChI=1S/C15H24BN3O2.C4H4N2/c1-14(2)15(3,4)21-16(20-14)12-5-6-13(18-11-12)19-9-7-17-8-10-19;1-2-5-4-6-3-1/h5-6,11,17H,7-10H2,1-4H3;1-4H |
| InChIKey | IUMGTZSHGJNSNR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|