C19H25N7O5 — CID 158812050
1-ethyl-4-[4-[(1R,7S)-10-hydroxy-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-4-methyliminobutanoyl]piperazine-2,3-dione (PubChem CID 158812050) has the molecular formula C19H25N7O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-ethyl-4-[4-[(1R,7S)-10-hydroxy-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-4-methyliminobutanoyl]piperazine-2,3-dione.
| Compound Name | 1-ethyl-4-[4-[(1R,7S)-10-hydroxy-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-4-methyliminobutanoyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 158812050 |
| Molecular Formula | C19H25N7O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-ethyl-4-[4-[(1R,7S)-10-hydroxy-5-methyl-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-4-methyliminobutanoyl]piperazine-2,3-dione |
| SMILES | CCN1CCN(C(=O)CC/C(=N\C)[C@@H]2c3c(cnn3C)[C@@H]3CN2C(=O)N3O)C(=O)C1=O |
| InChI | InChI=1S/C19H25N7O5/c1-4-23-7-8-24(18(29)17(23)28)14(27)6-5-12(20-2)16-15-11(9-21-22(15)3)13-10-25(16)19(30)26(13)31/h9,13,16,31H,4-8,10H2,1-3H3/b20-12+/t13-,16+/m0/s1 |
| InChIKey | QTTFSPRAKSGDSX-WKARSFIWSA-N |
| XLogP | -0.29 |
| TPSA | 131.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|