C51H42N4O3 — CID 158812647
1-[[4-(2-isocyanophenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid;1-[1-[[4-(2-isocyanophenyl)phenyl]methyl]-2,3-dimethylindol-5-yl]ethanone (PubChem CID 158812647) has the molecular formula C51H42N4O3 and a molecular weight of 758.92 g/mol. Its IUPAC name is 1-[[4-(2-isocyanophenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid;1-[1-[[4-(2-isocyanophenyl)phenyl]methyl]-2,3-dimethylindol-5-yl]ethanone.
| Compound Name | 1-[[4-(2-isocyanophenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid;1-[1-[[4-(2-isocyanophenyl)phenyl]methyl]-2,3-dimethylindol-5-yl]ethanone |
|---|---|
| PubChem CID | 158812647 |
| Molecular Formula | C51H42N4O3 |
| Molecular Weight | 758.92 g/mol |
| Exact Mass | 758.33 |
| IUPAC Name | 1-[[4-(2-isocyanophenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid;1-[1-[[4-(2-isocyanophenyl)phenyl]methyl]-2,3-dimethylindol-5-yl]ethanone |
| SMILES | [C-]#[N+]c1ccccc1-c1ccc(Cn2c(C)c(C)c3cc(C(=O)O)ccc32)cc1.[C-]#[N+]c1ccccc1-c1ccc(Cn2c(C)c(C)c3cc(C(C)=O)ccc32)cc1 |
| InChI | InChI=1S/C26H22N2O.C25H20N2O2/c1-17-18(2)28(26-14-13-22(19(3)29)15-24(17)26)16-20-9-11-21(12-10-20)23-7-5-6-8-25(23)27-4;1-16-17(2)27(24-13-12-20(25(28)29)14-22(16)24)15-18-8-10-19(11-9-18)21-6-4-5-7-23(21)26-3/h5-15H,16H2,1-3H3;4-14H,15H2,1-2H3,(H,28,29) |
| InChIKey | IUWMTWXUBIPLCX-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.92 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|