C22H13F12O3PS — CID 158813064
1,1,2,2,3,3-hexafluorobutane-1-sulfonate;phenyl-bis(2,4,6-trifluorophenyl)phosphanium (PubChem CID 158813064) has the molecular formula C22H13F12O3PS and a molecular weight of 616.36 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;phenyl-bis(2,4,6-trifluorophenyl)phosphanium.
| Compound Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;phenyl-bis(2,4,6-trifluorophenyl)phosphanium |
|---|---|
| PubChem CID | 158813064 |
| Molecular Formula | C22H13F12O3PS |
| Molecular Weight | 616.36 g/mol |
| Exact Mass | 616.01 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;phenyl-bis(2,4,6-trifluorophenyl)phosphanium |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].Fc1cc(F)c([PH+](c2ccccc2)c2c(F)cc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C18H9F6P.C4H4F6O3S/c19-10-6-13(21)17(14(22)7-10)25(12-4-2-1-3-5-12)18-15(23)8-11(20)9-16(18)24;1-2(5,6)3(7,8)4(9,10)14(11,12)13/h1-9H;1H3,(H,11,12,13) |
| InChIKey | IUXSXUNXBLZSNQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|