C10H17N5O2 — CID 158813356
[(5S)-3-amino-7-hydroxy-8-imino-2,7,9-triazatricyclo[7.3.0.01,5]dodec-2-en-6-yl]methanol (PubChem CID 158813356) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is [(5S)-3-amino-7-hydroxy-8-imino-2,7,9-triazatricyclo[7.3.0.01,5]dodec-2-en-6-yl]methanol.
| Compound Name | [(5S)-3-amino-7-hydroxy-8-imino-2,7,9-triazatricyclo[7.3.0.01,5]dodec-2-en-6-yl]methanol |
|---|---|
| PubChem CID | 158813356 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | [(5S)-3-amino-7-hydroxy-8-imino-2,7,9-triazatricyclo[7.3.0.01,5]dodec-2-en-6-yl]methanol |
| SMILES | [H]/N=C1\N(O)C(CO)[C@@H]2CC(N)=NC23CCCN13 |
| InChI | InChI=1S/C10H17N5O2/c11-8-4-6-7(5-16)15(17)9(12)14-3-1-2-10(6,14)13-8/h6-7,12,16-17H,1-5H2,(H2,11,13)/b12-9-/t6-,7?,10?/m0/s1 |
| InChIKey | KDGBPQPBHCNVEU-AFPXLROWSA-N |
| XLogP | -0.84 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|