C34H28N2NaO6P — CID 158814496
sodium bis[3-[1-cyano-3-(4-methylphenyl)-3-oxopropyl]phenyl] phosphate (PubChem CID 158814496) has the molecular formula C34H28N2NaO6P and a molecular weight of 614.57 g/mol. Its IUPAC name is sodium bis[3-[1-cyano-3-(4-methylphenyl)-3-oxopropyl]phenyl] phosphate.
| Compound Name | sodium bis[3-[1-cyano-3-(4-methylphenyl)-3-oxopropyl]phenyl] phosphate |
|---|---|
| PubChem CID | 158814496 |
| Molecular Formula | C34H28N2NaO6P |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.16 |
| IUPAC Name | sodium bis[3-[1-cyano-3-(4-methylphenyl)-3-oxopropyl]phenyl] phosphate |
| SMILES | Cc1ccc(C(=O)CC(C#N)c2cccc(OP(=O)([O-])Oc3cccc(C(C#N)CC(=O)c4ccc(C)cc4)c3)c2)cc1.[Na+] |
| InChI | InChI=1S/C34H29N2O6P.Na/c1-23-9-13-25(14-10-23)33(37)19-29(21-35)27-5-3-7-31(17-27)41-43(39,40)42-32-8-4-6-28(18-32)30(22-36)20-34(38)26-15-11-24(2)12-16-26;/h3-18,29-30H,19-20H2,1-2H3,(H,39,40);/q;+1/p-1 |
| InChIKey | IVCFGZMZYLEXBO-UHFFFAOYSA-M |
| XLogP | 3.99 |
| TPSA | 140.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|