About N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium
N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium (PubChem CID 158815033) has the molecular formula C10H19F3N3O2S+
and a molecular weight of 302.34 g/mol. Its IUPAC name is N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium.
Molecular Properties
| Compound Name | N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium |
| PubChem CID | 158815033 |
| Molecular Formula | C10H19F3N3O2S+ |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium |
| SMILES | CCC[N+]1(C)CCCC1.N#CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H18N.C2HF3N2O2S/c1-3-6-9(2)7-4-5-8-9;3-2(4,5)10(8,9)7-1-6/h3-8H2,1-2H3;7H/q+1; |
| InChIKey | WWIRMUOUPVWOPO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium?
The IUPAC name of N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium (CID 158815033) is N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium.
What is the SMILES notation for N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium?
The canonical SMILES for N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium is CCC[N+]1(C)CCCC1.N#CNS(=O)(=O)C(F)(F)F.
What is the InChIKey of N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium?
The InChIKey is WWIRMUOUPVWOPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N.C2HF3N2O2S/c1-3-6-9(2)7-4-5-8-9;3-2(4,5)10(8,9)7-1-6/h3-8H2,1-2H3;7H/q+1;.
What are the key properties of N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium?
N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium has a molecular weight of 302.34 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyano-1,1,1-trifluoromethanesulfonamide;1-methyl-1-propylpyrrolidin-1-ium is sourced from PubChem (CID 158815033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).