About 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide
4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide (PubChem CID 158815726) has the molecular formula C11H26N4O6S2
and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide.
Molecular Properties
| Compound Name | 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide |
| PubChem CID | 158815726 |
| Molecular Formula | C11H26N4O6S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide |
| SMILES | COC1CN(C)CC1S(N)(=O)=O.COC1CNCC1S(N)(=O)=O |
| InChI | InChI=1S/C6H14N2O3S.C5H12N2O3S/c1-8-3-5(11-2)6(4-8)12(7,9)10;1-10-4-2-7-3-5(4)11(6,8)9/h5-6H,3-4H2,1-2H3,(H2,7,9,10);4-5,7H,2-3H2,1H3,(H2,6,8,9) |
| InChIKey | IVFXUVGBNXWJOE-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide?
The IUPAC name of 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide (CID 158815726) is 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide.
What is the SMILES notation for 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide?
The canonical SMILES for 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide is COC1CN(C)CC1S(N)(=O)=O.COC1CNCC1S(N)(=O)=O.
What is the InChIKey of 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide?
The InChIKey is IVFXUVGBNXWJOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3S.C5H12N2O3S/c1-8-3-5(11-2)6(4-8)12(7,9)10;1-10-4-2-7-3-5(4)11(6,8)9/h5-6H,3-4H2,1-2H3,(H2,7,9,10);4-5,7H,2-3H2,1H3,(H2,6,8,9).
What are the key properties of 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide?
4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide has a molecular weight of 374.49 g/mol, XLogP of -3.13, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-methylpyrrolidine-3-sulfonamide;4-methoxypyrrolidine-3-sulfonamide is sourced from PubChem (CID 158815726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).