C30H29ClF2N2O4 — CID 158815890
(4S,5S)-3-[4-(4-chlorophenoxy)phenyl]-4-(3,5-difluorophenyl)-5-[5-(2-oxopyrrolidin-1-yl)pentyl]-1,3-oxazolidin-2-one (PubChem CID 158815890) has the molecular formula C30H29ClF2N2O4 and a molecular weight of 555.02 g/mol. Its IUPAC name is (4S,5S)-3-[4-(4-chlorophenoxy)phenyl]-4-(3,5-difluorophenyl)-5-[5-(2-oxopyrrolidin-1-yl)pentyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-3-[4-(4-chlorophenoxy)phenyl]-4-(3,5-difluorophenyl)-5-[5-(2-oxopyrrolidin-1-yl)pentyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 158815890 |
| Molecular Formula | C30H29ClF2N2O4 |
| Molecular Weight | 555.02 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | (4S,5S)-3-[4-(4-chlorophenoxy)phenyl]-4-(3,5-difluorophenyl)-5-[5-(2-oxopyrrolidin-1-yl)pentyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1CCCN1CCCCC[C@@H]1OC(=O)N(c2ccc(Oc3ccc(Cl)cc3)cc2)[C@H]1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C30H29ClF2N2O4/c31-21-7-11-25(12-8-21)38-26-13-9-24(10-14-26)35-29(20-17-22(32)19-23(33)18-20)27(39-30(35)37)5-2-1-3-15-34-16-4-6-28(34)36/h7-14,17-19,27,29H,1-6,15-16H2/t27-,29-/m0/s1 |
| InChIKey | IVGLCBWHHTZHST-YTMVLYRLSA-N |
| XLogP | 7.66 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.02 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|