ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate

C17H13Cl2NO2 — CID 15881638

IUPACethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate
SMILESCCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)cc2ccccn12
InChIInChI=1S/C17H13Cl2NO2/c1-2-22-17(21)16-13(10-12-5-3-4-8-20(12)16)11-6-7-14(18)15(19)9-11/h3-10H,2H2,1H3
InChIKeyPQHHJNWHKPFTAM-UHFFFAOYSA-N
MW334.20 g/mol
LogP5.09
Rot. Bonds3

About ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate

ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate (PubChem CID 15881638) has the molecular formula C17H13Cl2NO2 and a molecular weight of 334.20 g/mol. Its IUPAC name is ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate.

Molecular Properties

Compound Nameethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate
PubChem CID15881638
Molecular FormulaC17H13Cl2NO2
Molecular Weight334.20 g/mol
Exact Mass333.03
IUPAC Nameethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate
SMILESCCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)cc2ccccn12
InChIInChI=1S/C17H13Cl2NO2/c1-2-22-17(21)16-13(10-12-5-3-4-8-20(12)16)11-6-7-14(18)15(19)9-11/h3-10H,2H2,1H3
InChIKeyPQHHJNWHKPFTAM-UHFFFAOYSA-N
XLogP5.09
TPSA30.71 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500334.20
LogP ≤ 55.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate?
The IUPAC name of ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate (CID 15881638) is ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate.
What is the SMILES notation for ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate?
The canonical SMILES for ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate is CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)cc2ccccn12.
What is the InChIKey of ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate?
The InChIKey is PQHHJNWHKPFTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2NO2/c1-2-22-17(21)16-13(10-12-5-3-4-8-20(12)16)11-6-7-14(18)15(19)9-11/h3-10H,2H2,1H3.
What are the key properties of ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate?
ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate has a molecular weight of 334.20 g/mol, XLogP of 5.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3,4-dichlorophenyl)indolizine-3-carboxylate is sourced from PubChem (CID 15881638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).