About 1-(3-bromopropyl)-3,3-dimethylindol-2-one
1-(3-bromopropyl)-3,3-dimethylindol-2-one (PubChem CID 15881759) has the molecular formula C13H16BrNO
and a molecular weight of 282.18 g/mol. Its IUPAC name is 1-(3-bromopropyl)-3,3-dimethylindol-2-one.
Molecular Properties
| Compound Name | 1-(3-bromopropyl)-3,3-dimethylindol-2-one |
| PubChem CID | 15881759 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-(3-bromopropyl)-3,3-dimethylindol-2-one |
| SMILES | CC1(C)C(=O)N(CCCBr)c2ccccc21 |
| InChI | InChI=1S/C13H16BrNO/c1-13(2)10-6-3-4-7-11(10)15(12(13)16)9-5-8-14/h3-4,6-7H,5,8-9H2,1-2H3 |
| InChIKey | CTWRBFZWKLDHBI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromopropyl)-3,3-dimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromopropyl)-3,3-dimethylindol-2-one?
The IUPAC name of 1-(3-bromopropyl)-3,3-dimethylindol-2-one (CID 15881759) is 1-(3-bromopropyl)-3,3-dimethylindol-2-one.
What is the SMILES notation for 1-(3-bromopropyl)-3,3-dimethylindol-2-one?
The canonical SMILES for 1-(3-bromopropyl)-3,3-dimethylindol-2-one is CC1(C)C(=O)N(CCCBr)c2ccccc21.
What is the InChIKey of 1-(3-bromopropyl)-3,3-dimethylindol-2-one?
The InChIKey is CTWRBFZWKLDHBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO/c1-13(2)10-6-3-4-7-11(10)15(12(13)16)9-5-8-14/h3-4,6-7H,5,8-9H2,1-2H3.
What are the key properties of 1-(3-bromopropyl)-3,3-dimethylindol-2-one?
1-(3-bromopropyl)-3,3-dimethylindol-2-one has a molecular weight of 282.18 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromopropyl)-3,3-dimethylindol-2-one is sourced from PubChem (CID 15881759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).