About 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol
2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol (PubChem CID 158817867) has the molecular formula C16H23Br3N4O2
and a molecular weight of 543.10 g/mol. Its IUPAC name is 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol.
Molecular Properties
| Compound Name | 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol |
| PubChem CID | 158817867 |
| Molecular Formula | C16H23Br3N4O2 |
| Molecular Weight | 543.10 g/mol |
| Exact Mass | 539.94 |
| IUPAC Name | 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol |
| SMILES | Brc1ccc(Br)nc1.CN(CCO)c1ccc(Br)cn1.CNCCO |
| InChI | InChI=1S/C8H11BrN2O.C5H3Br2N.C3H9NO/c1-11(4-5-12)8-3-2-7(9)6-10-8;6-4-1-2-5(7)8-3-4;1-4-2-3-5/h2-3,6,12H,4-5H2,1H3;1-3H;4-5H,2-3H2,1H3 |
| InChIKey | IVMNIMAQACPZKA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.10 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol?
The IUPAC name of 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol (CID 158817867) is 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol.
What is the SMILES notation for 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol?
The canonical SMILES for 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol is Brc1ccc(Br)nc1.CN(CCO)c1ccc(Br)cn1.CNCCO.
What is the InChIKey of 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol?
The InChIKey is IVMNIMAQACPZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O.C5H3Br2N.C3H9NO/c1-11(4-5-12)8-3-2-7(9)6-10-8;6-4-1-2-5(7)8-3-4;1-4-2-3-5/h2-3,6,12H,4-5H2,1H3;1-3H;4-5H,2-3H2,1H3.
What are the key properties of 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol?
2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol has a molecular weight of 543.10 g/mol, XLogP of 3.08, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-bromo-2-pyridinyl)-methylamino]ethanol;2,5-dibromopyridine;2-(methylamino)ethanol is sourced from PubChem (CID 158817867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).